C25H25Cl3N2O2 — CID 17295394
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride (PubChem CID 17295394) has the molecular formula C25H25Cl3N2O2 and a molecular weight of 491.85 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17295394 |
| Molecular Formula | C25H25Cl3N2O2 |
| Molecular Weight | 491.85 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1H-indol-3-yl)ethanamine;hydrochloride |
| SMILES | COc1cc(CNCCc2c[nH]c3ccccc23)cc(Cl)c1OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C25H24Cl2N2O2.ClH/c1-30-24-13-17(12-22(27)25(24)31-16-19-6-2-4-8-21(19)26)14-28-11-10-18-15-29-23-9-5-3-7-20(18)23;/h2-9,12-13,15,28-29H,10-11,14,16H2,1H3;1H |
| InChIKey | SMKJNITVAUHTFG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.85 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|