C17H19Cl2NO3 — CID 2215596
2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethanol (PubChem CID 2215596) has the molecular formula C17H19Cl2NO3 and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethanol.
| Compound Name | 2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 2215596 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethanol |
| SMILES | COc1cc(CNCCO)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C17H19Cl2NO3/c1-22-16-9-12(10-20-6-7-21)8-15(19)17(16)23-11-13-4-2-3-5-14(13)18/h2-5,8-9,20-21H,6-7,10-11H2,1H3 |
| InChIKey | XNBYSSAJBPEUKS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|