C19H23Cl2NO2 — CID 4717010
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-1-amine (PubChem CID 4717010) has the molecular formula C19H23Cl2NO2 and a molecular weight of 368.30 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 4717010 |
| Molecular Formula | C19H23Cl2NO2 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-1-amine |
| SMILES | COc1cc(CNCC(C)C)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C19H23Cl2NO2/c1-13(2)10-22-11-14-8-17(21)19(18(9-14)23-3)24-12-15-6-4-5-7-16(15)20/h4-9,13,22H,10-12H2,1-3H3 |
| InChIKey | LYGGUVRKCCNPIS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |