C17H19BrCl3NO2 — CID 17209764
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride (PubChem CID 17209764) has the molecular formula C17H19BrCl3NO2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17209764 |
| Molecular Formula | C17H19BrCl3NO2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 452.97 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
| SMILES | COc1cc(CNCCc2ccc(Cl)cc2Cl)cc(Br)c1OC.Cl |
| InChI | InChI=1S/C17H18BrCl2NO2.ClH/c1-22-16-8-11(7-14(18)17(16)23-2)10-21-6-5-12-3-4-13(19)9-15(12)20;/h3-4,7-9,21H,5-6,10H2,1-2H3;1H |
| InChIKey | AVLJVIFQTNSEKM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|