C12H14FN5O2 — CID 2304316
4-amino-N-[2-[(4-fluorophenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 2304316) has the molecular formula C12H14FN5O2 and a molecular weight of 279.28 g/mol. Its IUPAC name is 4-amino-N-[2-[(4-fluorophenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-[(4-fluorophenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 2304316 |
| Molecular Formula | C12H14FN5O2 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4-amino-N-[2-[(4-fluorophenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FN5O2/c13-9-3-1-8(2-4-9)7-15-5-6-16-12(19)10-11(14)18-20-17-10/h1-4,15H,5-7H2,(H2,14,18)(H,16,19) |
| InChIKey | UFCDNVDECLAPHQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|