C13H16N6O4 — CID 50748711
4-amino-N-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 50748711) has the molecular formula C13H16N6O4 and a molecular weight of 320.31 g/mol. Its IUPAC name is 4-amino-N-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 50748711 |
| Molecular Formula | C13H16N6O4 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-amino-N-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)NCCNC(=O)c2nonc2N)cc1 |
| InChI | InChI=1S/C13H16N6O4/c1-22-9-4-2-8(3-5-9)17-13(21)16-7-6-15-12(20)10-11(14)19-23-18-10/h2-5H,6-7H2,1H3,(H2,14,19)(H,15,20)(H2,16,17,21) |
| InChIKey | GRSUUPUCJXWCDG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|