C14H16N6O5 — CID 46268573
4-amino-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 46268573) has the molecular formula C14H16N6O5 and a molecular weight of 348.32 g/mol. Its IUPAC name is 4-amino-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 46268573 |
| Molecular Formula | C14H16N6O5 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-amino-N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCNC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H16N6O5/c15-12-11(19-25-20-12)13(21)16-3-4-17-14(22)18-8-1-2-9-10(7-8)24-6-5-23-9/h1-2,7H,3-6H2,(H2,15,20)(H,16,21)(H2,17,18,22) |
| InChIKey | SHBLBSQHIMDQTD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|