C12H13N5O3 — CID 4316930
4-amino-N-(2-benzamidoethyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 4316930) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 4-amino-N-(2-benzamidoethyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(2-benzamidoethyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 4316930 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-amino-N-(2-benzamidoethyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13N5O3/c13-10-9(16-20-17-10)12(19)15-7-6-14-11(18)8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,13,17)(H,14,18)(H,15,19) |
| InChIKey | MHJRLPBVJRVZHZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|