C8H14N4O3 — CID 106134755
4-amino-N-(4-hydroxypentyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 106134755) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-amino-N-(4-hydroxypentyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(4-hydroxypentyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 106134755 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4-amino-N-(4-hydroxypentyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CC(O)CCCNC(=O)c1nonc1N |
| InChI | InChI=1S/C8H14N4O3/c1-5(13)3-2-4-10-8(14)6-7(9)12-15-11-6/h5,13H,2-4H2,1H3,(H2,9,12)(H,10,14) |
| InChIKey | MPLIWDZAMSFOPP-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|