C9H16N4O3 — CID 62688546
4-amino-N-(2-butoxyethyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 62688546) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-amino-N-(2-butoxyethyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(2-butoxyethyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 62688546 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-amino-N-(2-butoxyethyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CCCCOCCNC(=O)c1nonc1N |
| InChI | InChI=1S/C9H16N4O3/c1-2-3-5-15-6-4-11-9(14)7-8(10)13-16-12-7/h2-6H2,1H3,(H2,10,13)(H,11,14) |
| InChIKey | HAVWFBICXZDDHX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|