C10H16N4O4 — CID 58248586
4-amino-N-(7-hydroxy-6-oxoheptyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 58248586) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-amino-N-(7-hydroxy-6-oxoheptyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(7-hydroxy-6-oxoheptyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 58248586 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-amino-N-(7-hydroxy-6-oxoheptyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCCCCC(=O)CO |
| InChI | InChI=1S/C10H16N4O4/c11-9-8(13-18-14-9)10(17)12-5-3-1-2-4-7(16)6-15/h15H,1-6H2,(H2,11,14)(H,12,17) |
| InChIKey | TVVLFJCHQQVCFB-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|