C11H12N4O2S — CID 55091034
4-amino-N-(2-phenylsulfanylethyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 55091034) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-amino-N-(2-phenylsulfanylethyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(2-phenylsulfanylethyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 55091034 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-amino-N-(2-phenylsulfanylethyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C11H12N4O2S/c12-10-9(14-17-15-10)11(16)13-6-7-18-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,12,15)(H,13,16) |
| InChIKey | DWNVQIOMOMBPHL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|