C23H23N3O2S2 — CID 2174445
2-N,5-N-bis(2-phenylsulfanylethyl)pyridine-2,5-dicarboxamide (PubChem CID 2174445) has the molecular formula C23H23N3O2S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-N,5-N-bis(2-phenylsulfanylethyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(2-phenylsulfanylethyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 2174445 |
| Molecular Formula | C23H23N3O2S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-N,5-N-bis(2-phenylsulfanylethyl)pyridine-2,5-dicarboxamide |
| SMILES | O=C(NCCSc1ccccc1)c1ccc(C(=O)NCCSc2ccccc2)nc1 |
| InChI | InChI=1S/C23H23N3O2S2/c27-22(24-13-15-29-19-7-3-1-4-8-19)18-11-12-21(26-17-18)23(28)25-14-16-30-20-9-5-2-6-10-20/h1-12,17H,13-16H2,(H,24,27)(H,25,28) |
| InChIKey | QMYRGYXLBVRAKP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|