C21H27NO4S — CID 27677815
3,4,5-triethoxy-N-(2-phenylsulfanylethyl)benzamide (PubChem CID 27677815) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(2-phenylsulfanylethyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(2-phenylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 27677815 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3,4,5-triethoxy-N-(2-phenylsulfanylethyl)benzamide |
| SMILES | CCOc1cc(C(=O)NCCSc2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H27NO4S/c1-4-24-18-14-16(15-19(25-5-2)20(18)26-6-3)21(23)22-12-13-27-17-10-8-7-9-11-17/h7-11,14-15H,4-6,12-13H2,1-3H3,(H,22,23) |
| InChIKey | NLLQIWIOPYOCRJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|