C21H27NO3S — CID 38006736
3-(3,4-diethoxyphenyl)-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 38006736) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 38006736 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)NCCSc2ccccc2)cc1OCC |
| InChI | InChI=1S/C21H27NO3S/c1-3-24-19-12-10-17(16-20(19)25-4-2)11-13-21(23)22-14-15-26-18-8-6-5-7-9-18/h5-10,12,16H,3-4,11,13-15H2,1-2H3,(H,22,23) |
| InChIKey | UNYVXPWNJAMWEU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|