C22H28ClNO3 — CID 43908360
N-[3-(2-chlorophenyl)propyl]-3-(3,4-diethoxyphenyl)propanamide (PubChem CID 43908360) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)propyl]-3-(3,4-diethoxyphenyl)propanamide.
| Compound Name | N-[3-(2-chlorophenyl)propyl]-3-(3,4-diethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 43908360 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[3-(2-chlorophenyl)propyl]-3-(3,4-diethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)NCCCc2ccccc2Cl)cc1OCC |
| InChI | InChI=1S/C22H28ClNO3/c1-3-26-20-13-11-17(16-21(20)27-4-2)12-14-22(25)24-15-7-9-18-8-5-6-10-19(18)23/h5-6,8,10-11,13,16H,3-4,7,9,12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | MVBYQCTVHAJEMI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|