C21H25ClN2O4 — CID 9474002
2-chloro-N-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 9474002) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9474002 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-chloro-N-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(CCNC(=O)CNC(=O)c2ccccc2Cl)cc1OCC |
| InChI | InChI=1S/C21H25ClN2O4/c1-3-27-18-10-9-15(13-19(18)28-4-2)11-12-23-20(25)14-24-21(26)16-7-5-6-8-17(16)22/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ARLYIMIKIFVKSP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |