C21H25ClN2O4 — CID 9418929
2-chloro-N-[2-[[(1R)-1-(3,4-diethoxyphenyl)ethyl]amino]-2-oxoethyl]benzamide (PubChem CID 9418929) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-chloro-N-[2-[[(1R)-1-(3,4-diethoxyphenyl)ethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[(1R)-1-(3,4-diethoxyphenyl)ethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9418929 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-chloro-N-[2-[[(1R)-1-(3,4-diethoxyphenyl)ethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)CNC(=O)c2ccccc2Cl)cc1OCC |
| InChI | InChI=1S/C21H25ClN2O4/c1-4-27-18-11-10-15(12-19(18)28-5-2)14(3)24-20(25)13-23-21(26)16-8-6-7-9-17(16)22/h6-12,14H,4-5,13H2,1-3H3,(H,23,26)(H,24,25)/t14-/m1/s1 |
| InChIKey | RIGIXJOVPQFWDY-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |