C21H25ClN2O5 — CID 55869434
2-chloro-N-[2-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylamino]-2-oxoethyl]benzamide (PubChem CID 55869434) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55869434 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-chloro-N-[2-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethylamino]-2-oxoethyl]benzamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)CNC(=O)c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C21H25ClN2O5/c1-14(15-8-9-18(19(12-15)28-3)29-11-10-27-2)24-20(25)13-23-21(26)16-6-4-5-7-17(16)22/h4-9,12,14H,10-11,13H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | FIHGOBLTAZJYQX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|