C18H18F2N2O3 — CID 17406382
2-fluoro-N-[2-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 17406382) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-fluoro-N-[2-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17406382 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-fluoro-N-[2-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | COc1ccc(C(C)NC(=O)CNC(=O)c2ccccc2F)cc1F |
| InChI | InChI=1S/C18H18F2N2O3/c1-11(12-7-8-16(25-2)15(20)9-12)22-17(23)10-21-18(24)13-5-3-4-6-14(13)19/h3-9,11H,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | HWGQVSVETDHEBI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |