C23H30N2O5 — CID 55845776
2-ethoxy-N-[2-[1-(3-methoxy-4-propoxyphenyl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 55845776) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[1-(3-methoxy-4-propoxyphenyl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-[1-(3-methoxy-4-propoxyphenyl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55845776 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-ethoxy-N-[2-[1-(3-methoxy-4-propoxyphenyl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)CNC(=O)c2ccccc2OCC)cc1OC |
| InChI | InChI=1S/C23H30N2O5/c1-5-13-30-20-12-11-17(14-21(20)28-4)16(3)25-22(26)15-24-23(27)18-9-7-8-10-19(18)29-6-2/h7-12,14,16H,5-6,13,15H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | WPKKDYVEVSSLAW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |