C24H33N3O4 — CID 56581932
3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]propanamide (PubChem CID 56581932) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 56581932 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]propanamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)CCNC(=O)N(C)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H33N3O4/c1-5-15-31-21-12-11-20(16-22(21)30-4)18(2)26-23(28)13-14-25-24(29)27(3)17-19-9-7-6-8-10-19/h6-12,16,18H,5,13-15,17H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | SMTVSCLAOHTZNG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |