C22H36N2O5 — CID 55747253
tert-butyl N-[3-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-3-oxopropyl]carbamate (PubChem CID 55747253) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 55747253 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | tert-butyl N-[3-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-3-oxopropyl]carbamate |
| SMILES | CCCCCOc1ccc(C(C)NC(=O)CCNC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C22H36N2O5/c1-7-8-9-14-28-18-11-10-17(15-19(18)27-6)16(2)24-20(25)12-13-23-21(26)29-22(3,4)5/h10-11,15-16H,7-9,12-14H2,1-6H3,(H,23,26)(H,24,25) |
| InChIKey | VNRBDRUKLLTWIM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|