C20H35ClN2O3 — CID 119722949
(2S)-2-amino-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-3,3-dimethylbutanamide;hydrochloride (PubChem CID 119722949) has the molecular formula C20H35ClN2O3 and a molecular weight of 386.96 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-3,3-dimethylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-3,3-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119722949 |
| Molecular Formula | C20H35ClN2O3 |
| Molecular Weight | 386.96 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (2S)-2-amino-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-3,3-dimethylbutanamide;hydrochloride |
| SMILES | CCCCCOc1ccc(C(C)NC(=O)[C@@H](N)C(C)(C)C)cc1OC.Cl |
| InChI | InChI=1S/C20H34N2O3.ClH/c1-7-8-9-12-25-16-11-10-15(13-17(16)24-6)14(2)22-19(23)18(21)20(3,4)5;/h10-11,13-14,18H,7-9,12,21H2,1-6H3,(H,22,23);1H/t14?,18-;/m1./s1 |
| InChIKey | RVNSCDBOEHFYRC-HYQBYDJKSA-N |
| XLogP | 4.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|