C19H27N3O3S — CID 119722954
2-(aminomethyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 119722954) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119722954 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-(aminomethyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCOc1ccc(C(C)NC(=O)c2csc(CN)n2)cc1OC |
| InChI | InChI=1S/C19H27N3O3S/c1-4-5-6-9-25-16-8-7-14(10-17(16)24-3)13(2)21-19(23)15-12-26-18(11-20)22-15/h7-8,10,12-13H,4-6,9,11,20H2,1-3H3,(H,21,23) |
| InChIKey | PMPMKUJYCMVXQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|