C23H33N3O4S — CID 55785679
N-[4-[2-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide (PubChem CID 55785679) has the molecular formula C23H33N3O4S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[4-[2-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[4-[2-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55785679 |
| Molecular Formula | C23H33N3O4S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[4-[2-[1-(3-methoxy-4-pentoxyphenyl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
| SMILES | CCCCCOc1ccc(C(C)NC(=O)Cc2csc(NC(=O)C(C)C)n2)cc1OC |
| InChI | InChI=1S/C23H33N3O4S/c1-6-7-8-11-30-19-10-9-17(12-20(19)29-5)16(4)24-21(27)13-18-14-31-23(25-18)26-22(28)15(2)3/h9-10,12,14-16H,6-8,11,13H2,1-5H3,(H,24,27)(H,25,26,28) |
| InChIKey | RXSRJVIENKDSAB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|