C18H23N3O4S — CID 18567989
N-[4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide (PubChem CID 18567989) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 18567989 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide |
| SMILES | CCCCNC(=O)Cc1csc(NC(=O)c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C18H23N3O4S/c1-4-5-8-19-16(22)10-13-11-26-18(20-13)21-17(23)12-6-7-14(24-2)15(9-12)25-3/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,19,22)(H,20,21,23) |
| InChIKey | JDALQQKDQKYSDM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|