C17H22N4O4S — CID 19611226
N-(4-aminobutyl)-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 19611226) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-aminobutyl)-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 19611226 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(4-aminobutyl)-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nc(C(=O)NCCCCN)cs2)cc1OC |
| InChI | InChI=1S/C17H22N4O4S/c1-24-13-6-5-11(9-14(13)25-2)15(22)21-17-20-12(10-26-17)16(23)19-8-4-3-7-18/h5-6,9-10H,3-4,7-8,18H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | GBHYGTJXIGMOTM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|