C17H23N3O3S — CID 120626306
2-(2-aminoethyl)-N-[3-(3,4-dimethoxyphenyl)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 120626306) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[3-(3,4-dimethoxyphenyl)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-[3-(3,4-dimethoxyphenyl)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 120626306 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(2-aminoethyl)-N-[3-(3,4-dimethoxyphenyl)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)c2csc(CCN)n2)cc1OC |
| InChI | InChI=1S/C17H23N3O3S/c1-22-14-6-5-12(10-15(14)23-2)4-3-9-19-17(21)13-11-24-16(20-13)7-8-18/h5-6,10-11H,3-4,7-9,18H2,1-2H3,(H,19,21) |
| InChIKey | MWORSSQDDWNJQP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|