C17H24ClN3O3S — CID 119786408
2-(aminomethyl)-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119786408) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119786408 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CCOc1cc(CCCNC(=O)c2csc(CN)n2)ccc1OC.Cl |
| InChI | InChI=1S/C17H23N3O3S.ClH/c1-3-23-15-9-12(6-7-14(15)22-2)5-4-8-19-17(21)13-11-24-16(10-18)20-13;/h6-7,9,11H,3-5,8,10,18H2,1-2H3,(H,19,21);1H |
| InChIKey | BMLBJWYRNBTLPB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|