C21H32N4O2S — CID 111574681
1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111574681) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111574681 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCOc1cc(CCCN/C(=N/C)NCCc2csc(CC)n2)ccc1OC |
| InChI | InChI=1S/C21H32N4O2S/c1-5-20-25-17(15-28-20)11-13-24-21(22-3)23-12-7-8-16-9-10-18(26-4)19(14-16)27-6-2/h9-10,14-15H,5-8,11-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | OXRWKIBXHAWMED-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|