C28H37N3O4S — CID 3666683
2-[[2-(3,4-dimethoxyphenyl)ethyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide (PubChem CID 3666683) has the molecular formula C28H37N3O4S and a molecular weight of 511.69 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)ethyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)ethyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3666683 |
| Molecular Formula | C28H37N3O4S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)ethyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1csc(CN(CCc2ccc(OC)c(OC)c2)Cc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C28H37N3O4S/c1-5-6-7-15-29-28(32)24-20-36-27(30-24)19-31(18-22-8-11-23(33-2)12-9-22)16-14-21-10-13-25(34-3)26(17-21)35-4/h8-13,17,20H,5-7,14-16,18-19H2,1-4H3,(H,29,32) |
| InChIKey | KHBIDHGTWFKRDP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|