C28H37N3O5S — CID 4178366
N-butyl-2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 4178366) has the molecular formula C28H37N3O5S and a molecular weight of 527.69 g/mol. Its IUPAC name is N-butyl-2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4178366 |
| Molecular Formula | C28H37N3O5S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-butyl-2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(CCc2ccc(OC)c(OC)c2)Cc2ccc(OC)cc2OC)n1 |
| InChI | InChI=1S/C28H37N3O5S/c1-6-7-13-29-28(32)23-19-37-27(30-23)18-31(17-21-9-10-22(33-2)16-25(21)35-4)14-12-20-8-11-24(34-3)26(15-20)36-5/h8-11,15-16,19H,6-7,12-14,17-18H2,1-5H3,(H,29,32) |
| InChIKey | GGUAKIDFKDWPLF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|