C34H39N5O7S — CID 5092648
[2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 5092648) has the molecular formula C34H39N5O7S and a molecular weight of 661.78 g/mol. Its IUPAC name is [2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 5092648 |
| Molecular Formula | C34H39N5O7S |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | [2-[[2-(3,4-dimethoxyphenyl)ethyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(CN(CCc2ccc(OC)c(OC)c2)Cc2nc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)c(OC)c1 |
| InChI | InChI=1S/C34H39N5O7S/c1-43-28-11-6-25(31(20-28)45-3)21-36(14-13-24-5-12-30(44-2)32(19-24)46-4)22-33-35-29(23-47-33)34(40)38-17-15-37(16-18-38)26-7-9-27(10-8-26)39(41)42/h5-12,19-20,23H,13-18,21-22H2,1-4H3 |
| InChIKey | WWTYSXYIPBNBMP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 119.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|