C10H18ClN3O2S — CID 119675579
2-(aminomethyl)-N-(3-ethoxypropyl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119675579) has the molecular formula C10H18ClN3O2S and a molecular weight of 279.79 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-ethoxypropyl)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-(3-ethoxypropyl)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119675579 |
| Molecular Formula | C10H18ClN3O2S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-(aminomethyl)-N-(3-ethoxypropyl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CCOCCCNC(=O)c1csc(CN)n1.Cl |
| InChI | InChI=1S/C10H17N3O2S.ClH/c1-2-15-5-3-4-12-10(14)8-7-16-9(6-11)13-8;/h7H,2-6,11H2,1H3,(H,12,14);1H |
| InChIKey | PRWMTDSPWYALKH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|