C12H21ClN4O2S — CID 119763190
2-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119763190) has the molecular formula C12H21ClN4O2S and a molecular weight of 320.85 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119763190 |
| Molecular Formula | C12H21ClN4O2S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CC(C)(C)C(=O)NCCNC(=O)c1csc(CN)n1.Cl |
| InChI | InChI=1S/C12H20N4O2S.ClH/c1-12(2,3)11(18)15-5-4-14-10(17)8-7-19-9(6-13)16-8;/h7H,4-6,13H2,1-3H3,(H,14,17)(H,15,18);1H |
| InChIKey | HCYPWCXRFHYATB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|