C14H21Cl2N5OS — CID 119888059
2-(aminomethyl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119888059) has the molecular formula C14H21Cl2N5OS and a molecular weight of 378.33 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-(aminomethyl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119888059 |
| Molecular Formula | C14H21Cl2N5OS |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-(aminomethyl)-N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(NCCCNC(=O)c2csc(CN)n2)nc1.Cl.Cl |
| InChI | InChI=1S/C14H19N5OS.2ClH/c1-10-3-4-12(18-8-10)16-5-2-6-17-14(20)11-9-21-13(7-15)19-11;;/h3-4,8-9H,2,5-7,15H2,1H3,(H,16,18)(H,17,20);2*1H |
| InChIKey | WNUFXLYQEKJBEO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|