C16H22ClN3OS — CID 119772378
2-(aminomethyl)-N-(5-phenylpentyl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119772378) has the molecular formula C16H22ClN3OS and a molecular weight of 339.89 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(5-phenylpentyl)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-(5-phenylpentyl)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119772378 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-(aminomethyl)-N-(5-phenylpentyl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCc1nc(C(=O)NCCCCCc2ccccc2)cs1 |
| InChI | InChI=1S/C16H21N3OS.ClH/c17-11-15-19-14(12-21-15)16(20)18-10-6-2-5-9-13-7-3-1-4-8-13;/h1,3-4,7-8,12H,2,5-6,9-11,17H2,(H,18,20);1H |
| InChIKey | HKRMNAOHRRAYLO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|