C14H19Cl2N3OS — CID 119405606
N-(3-aminopropyl)-2-benzyl-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119405606) has the molecular formula C14H19Cl2N3OS and a molecular weight of 348.30 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-benzyl-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-2-benzyl-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119405606 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(3-aminopropyl)-2-benzyl-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCNC(=O)c1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H17N3OS.2ClH/c15-7-4-8-16-14(18)12-10-19-13(17-12)9-11-5-2-1-3-6-11;;/h1-3,5-6,10H,4,7-9,15H2,(H,16,18);2*1H |
| InChIKey | BUGQDKLOUYSOQX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|