C18H19N3OS2 — CID 70713753
2-benzyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 70713753) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-benzyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 70713753 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-benzyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)c2csc(Cc3ccccc3)n2)n1 |
| InChI | InChI=1S/C18H19N3OS2/c1-13-11-23-16(20-13)8-5-9-19-18(22)15-12-24-17(21-15)10-14-6-3-2-4-7-14/h2-4,6-7,11-12H,5,8-10H2,1H3,(H,19,22) |
| InChIKey | GTXIRDNPWHXDFR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|