C14H20N4OS2 — CID 120646096
2-(2-aminoethyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1,3-thiazole-4-carboxamide (PubChem CID 120646096) has the molecular formula C14H20N4OS2 and a molecular weight of 324.48 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 120646096 |
| Molecular Formula | C14H20N4OS2 |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(2-aminoethyl)-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1csc(CCCCNC(=O)c2csc(CCN)n2)n1 |
| InChI | InChI=1S/C14H20N4OS2/c1-10-8-20-12(17-10)4-2-3-7-16-14(19)11-9-21-13(18-11)5-6-15/h8-9H,2-7,15H2,1H3,(H,16,19) |
| InChIKey | MAKWIRRWRCLBLR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|