C13H21N3O3S — CID 120617892
methyl 6-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]hexanoate (PubChem CID 120617892) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is methyl 6-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 120617892 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 6-[[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1csc(CCN)n1 |
| InChI | InChI=1S/C13H21N3O3S/c1-19-12(17)5-3-2-4-8-15-13(18)10-9-20-11(16-10)6-7-14/h9H,2-8,14H2,1H3,(H,15,18) |
| InChIKey | XWJIKJZWOUGYHQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|