C8H14N4OS — CID 66389522
N,2-bis(2-aminoethyl)-1,3-thiazole-4-carboxamide (PubChem CID 66389522) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is N,2-bis(2-aminoethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N,2-bis(2-aminoethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66389522 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N,2-bis(2-aminoethyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCNC(=O)c1csc(CCN)n1 |
| InChI | InChI=1S/C8H14N4OS/c9-2-1-7-12-6(5-14-7)8(13)11-4-3-10/h5H,1-4,9-10H2,(H,11,13) |
| InChIKey | NCTKSYDHIWEHLC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |