C13H14N2OS — CID 38018562
2-benzyl-N-ethyl-1,3-thiazole-4-carboxamide (PubChem CID 38018562) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-benzyl-N-ethyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzyl-N-ethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 38018562 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-benzyl-N-ethyl-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C13H14N2OS/c1-2-14-13(16)11-9-17-12(15-11)8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,14,16) |
| InChIKey | LGYJBOAOHQICLT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |