C14H16N2OS — CID 38766578
2-benzyl-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 38766578) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-benzyl-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 38766578 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-benzyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H16N2OS/c1-10(2)15-14(17)12-9-18-13(16-12)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,15,17) |
| InChIKey | HEWIHLGAYWJDIC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |