C19H26N2OS — CID 78863881
2-benzyl-N,N-bis(2-methylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 78863881) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-benzyl-N,N-bis(2-methylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzyl-N,N-bis(2-methylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 78863881 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-benzyl-N,N-bis(2-methylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H26N2OS/c1-14(2)11-21(12-15(3)4)19(22)17-13-23-18(20-17)10-16-8-6-5-7-9-16/h5-9,13-15H,10-12H2,1-4H3 |
| InChIKey | WNLOMPCCEXOSAD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |