C14H18N4OS — CID 119867801
2-(aminomethyl)-N-(3-anilinopropyl)-1,3-thiazole-4-carboxamide (PubChem CID 119867801) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-anilinopropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(3-anilinopropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119867801 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(aminomethyl)-N-(3-anilinopropyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)NCCCNc2ccccc2)cs1 |
| InChI | InChI=1S/C14H18N4OS/c15-9-13-18-12(10-20-13)14(19)17-8-4-7-16-11-5-2-1-3-6-11/h1-3,5-6,10,16H,4,7-9,15H2,(H,17,19) |
| InChIKey | OOLZSTNEMIHOGN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|