C14H17ClFN3OS2 — CID 119683965
2-(aminomethyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119683965) has the molecular formula C14H17ClFN3OS2 and a molecular weight of 361.90 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119683965 |
| Molecular Formula | C14H17ClFN3OS2 |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCc1nc(C(=O)NCCCSc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C14H16FN3OS2.ClH/c15-10-2-4-11(5-3-10)20-7-1-6-17-14(19)12-9-21-13(8-16)18-12;/h2-5,9H,1,6-8,16H2,(H,17,19);1H |
| InChIKey | WLFBRLUYJQQBHV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|