C9H14N2O3S — CID 66378778
2-ethoxyethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate (PubChem CID 66378778) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-ethoxyethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 66378778 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-ethoxyethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOCCOC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C9H14N2O3S/c1-2-13-3-4-14-9(12)7-6-15-8(5-10)11-7/h6H,2-5,10H2,1H3 |
| InChIKey | QFIXJJABJMZUBL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|