C14H16N2O2S — CID 66380535
3-phenylpropyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate (PubChem CID 66380535) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-phenylpropyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 3-phenylpropyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 66380535 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-phenylpropyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate |
| SMILES | NCc1nc(C(=O)OCCCc2ccccc2)cs1 |
| InChI | InChI=1S/C14H16N2O2S/c15-9-13-16-12(10-19-13)14(17)18-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9,15H2 |
| InChIKey | BQJCTOZHHQRITQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|